C19H20F3N3OS2 — CID 3497239
4-(2-methylsulfanylphenyl)-N-[4-(trifluoromethylsulfanyl)phenyl]piperazine-1-carboxamide (PubChem CID 3497239) has the molecular formula C19H20F3N3OS2 and a molecular weight of 427.52 g/mol. Its IUPAC name is 4-(2-methylsulfanylphenyl)-N-[4-(trifluoromethylsulfanyl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-(2-methylsulfanylphenyl)-N-[4-(trifluoromethylsulfanyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 3497239 |
| Molecular Formula | C19H20F3N3OS2 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 4-(2-methylsulfanylphenyl)-N-[4-(trifluoromethylsulfanyl)phenyl]piperazine-1-carboxamide |
| SMILES | CSc1ccccc1N1CCN(C(=O)Nc2ccc(SC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H20F3N3OS2/c1-27-17-5-3-2-4-16(17)24-10-12-25(13-11-24)18(26)23-14-6-8-15(9-7-14)28-19(20,21)22/h2-9H,10-13H2,1H3,(H,23,26) |
| InChIKey | LDJAPFMJFLBCSM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |