C21H23N3O3 — CID 8835101
N-(3-cyanophenyl)-2-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]acetamide (PubChem CID 8835101) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]acetamide.
| Compound Name | N-(3-cyanophenyl)-2-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 8835101 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-(3-cyanophenyl)-2-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]acetamide |
| SMILES | COc1ccc([C@@H]2CCCN2CC(=O)Nc2cccc(C#N)c2)c(OC)c1 |
| InChI | InChI=1S/C21H23N3O3/c1-26-17-8-9-18(20(12-17)27-2)19-7-4-10-24(19)14-21(25)23-16-6-3-5-15(11-16)13-22/h3,5-6,8-9,11-12,19H,4,7,10,14H2,1-2H3,(H,23,25)/t19-/m0/s1 |
| InChIKey | BBRNROPGVLEDDK-IBGZPJMESA-N |
| XLogP | 3.35 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |