C16H14ClF4N5S — CID 2795590
N-(3-chloro-4-fluorophenyl)-4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carbothioamide (PubChem CID 2795590) has the molecular formula C16H14ClF4N5S and a molecular weight of 419.84 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carbothioamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 2795590 |
| Molecular Formula | C16H14ClF4N5S |
| Molecular Weight | 419.84 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carbothioamide |
| SMILES | Fc1ccc(NC(=S)N2CCN(c3nccc(C(F)(F)F)n3)CC2)cc1Cl |
| InChI | InChI=1S/C16H14ClF4N5S/c17-11-9-10(1-2-12(11)18)23-15(27)26-7-5-25(6-8-26)14-22-4-3-13(24-14)16(19,20)21/h1-4,9H,5-8H2,(H,23,27) |
| InChIKey | HTRFOKKCSWZXCA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.84 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|