C19H15N3O2S — CID 17417464
N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(5-phenyl-1,3-oxazol-2-yl)benzamide (PubChem CID 17417464) has the molecular formula C19H15N3O2S and a molecular weight of 349.42 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(5-phenyl-1,3-oxazol-2-yl)benzamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(5-phenyl-1,3-oxazol-2-yl)benzamide |
|---|---|
| PubChem CID | 17417464 |
| Molecular Formula | C19H15N3O2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(5-phenyl-1,3-oxazol-2-yl)benzamide |
| SMILES | O=C(NC1=NCCS1)c1ccccc1-c1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C19H15N3O2S/c23-17(22-19-20-10-11-25-19)14-8-4-5-9-15(14)18-21-12-16(24-18)13-6-2-1-3-7-13/h1-9,12H,10-11H2,(H,20,22,23) |
| InChIKey | CVVPJLVUUOMHIT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |