C25H21N3O3S — CID 56533280
S-[4-[[2-(5-phenyl-1,3-oxazol-2-yl)benzoyl]amino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56533280) has the molecular formula C25H21N3O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is S-[4-[[2-(5-phenyl-1,3-oxazol-2-yl)benzoyl]amino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[[2-(5-phenyl-1,3-oxazol-2-yl)benzoyl]amino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56533280 |
| Molecular Formula | C25H21N3O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | S-[4-[[2-(5-phenyl-1,3-oxazol-2-yl)benzoyl]amino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccc(NC(=O)c2ccccc2-c2ncc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C25H21N3O3S/c1-28(2)25(30)32-19-14-12-18(13-15-19)27-23(29)20-10-6-7-11-21(20)24-26-16-22(31-24)17-8-4-3-5-9-17/h3-16H,1-2H3,(H,27,29) |
| InChIKey | NYMJASVETXUADJ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|