C23H19N3O4S — CID 24676064
2-(5-phenyl-1,3-oxazol-2-yl)-N-[4-(sulfamoylmethyl)phenyl]benzamide (PubChem CID 24676064) has the molecular formula C23H19N3O4S and a molecular weight of 433.49 g/mol. Its IUPAC name is 2-(5-phenyl-1,3-oxazol-2-yl)-N-[4-(sulfamoylmethyl)phenyl]benzamide.
| Compound Name | 2-(5-phenyl-1,3-oxazol-2-yl)-N-[4-(sulfamoylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 24676064 |
| Molecular Formula | C23H19N3O4S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 2-(5-phenyl-1,3-oxazol-2-yl)-N-[4-(sulfamoylmethyl)phenyl]benzamide |
| SMILES | NS(=O)(=O)Cc1ccc(NC(=O)c2ccccc2-c2ncc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C23H19N3O4S/c24-31(28,29)15-16-10-12-18(13-11-16)26-22(27)19-8-4-5-9-20(19)23-25-14-21(30-23)17-6-2-1-3-7-17/h1-14H,15H2,(H,26,27)(H2,24,28,29) |
| InChIKey | BXXONVCKGMIRBJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |