C19H18ClN3OS — CID 118708824
4-(4-chlorophenyl)-N-(4-morpholin-4-ylphenyl)-1,3-thiazol-2-amine (PubChem CID 118708824) has the molecular formula C19H18ClN3OS and a molecular weight of 371.89 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(4-morpholin-4-ylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(4-chlorophenyl)-N-(4-morpholin-4-ylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 118708824 |
| Molecular Formula | C19H18ClN3OS |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(4-morpholin-4-ylphenyl)-1,3-thiazol-2-amine |
| SMILES | Clc1ccc(-c2csc(Nc3ccc(N4CCOCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C19H18ClN3OS/c20-15-3-1-14(2-4-15)18-13-25-19(22-18)21-16-5-7-17(8-6-16)23-9-11-24-12-10-23/h1-8,13H,9-12H2,(H,21,22) |
| InChIKey | WYWWLOWSRITKOF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|