C18H18N4OS — CID 122192398
N-(4-morpholin-4-ylphenyl)-4-pyridin-2-yl-1,3-thiazol-2-amine (PubChem CID 122192398) has the molecular formula C18H18N4OS and a molecular weight of 338.44 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-4-pyridin-2-yl-1,3-thiazol-2-amine.
| Compound Name | N-(4-morpholin-4-ylphenyl)-4-pyridin-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 122192398 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-4-pyridin-2-yl-1,3-thiazol-2-amine |
| SMILES | c1ccc(-c2csc(Nc3ccc(N4CCOCC4)cc3)n2)nc1 |
| InChI | InChI=1S/C18H18N4OS/c1-2-8-19-16(3-1)17-13-24-18(21-17)20-14-4-6-15(7-5-14)22-9-11-23-12-10-22/h1-8,13H,9-12H2,(H,20,21) |
| InChIKey | HCDREACMELFKJV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|