C16H17N5S2 — CID 163214659
N-(4-piperazin-1-ylphenyl)-4-(1,3-thiazol-2-yl)-1,3-thiazol-2-amine (PubChem CID 163214659) has the molecular formula C16H17N5S2 and a molecular weight of 343.48 g/mol. Its IUPAC name is N-(4-piperazin-1-ylphenyl)-4-(1,3-thiazol-2-yl)-1,3-thiazol-2-amine.
| Compound Name | N-(4-piperazin-1-ylphenyl)-4-(1,3-thiazol-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 163214659 |
| Molecular Formula | C16H17N5S2 |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | N-(4-piperazin-1-ylphenyl)-4-(1,3-thiazol-2-yl)-1,3-thiazol-2-amine |
| SMILES | c1csc(-c2csc(Nc3ccc(N4CCNCC4)cc3)n2)n1 |
| InChI | InChI=1S/C16H17N5S2/c1-3-13(21-8-5-17-6-9-21)4-2-12(1)19-16-20-14(11-23-16)15-18-7-10-22-15/h1-4,7,10-11,17H,5-6,8-9H2,(H,19,20) |
| InChIKey | ICIKRKKQHLPMTG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|