C20H21IN4S — CID 58910824
N-(4-iodophenyl)-4-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-thiazol-2-amine (PubChem CID 58910824) has the molecular formula C20H21IN4S and a molecular weight of 476.39 g/mol. Its IUPAC name is N-(4-iodophenyl)-4-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-thiazol-2-amine.
| Compound Name | N-(4-iodophenyl)-4-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58910824 |
| Molecular Formula | C20H21IN4S |
| Molecular Weight | 476.39 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | N-(4-iodophenyl)-4-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-thiazol-2-amine |
| SMILES | CN1CCN(c2ccc(-c3csc(Nc4ccc(I)cc4)n3)cc2)CC1 |
| InChI | InChI=1S/C20H21IN4S/c1-24-10-12-25(13-11-24)18-8-2-15(3-9-18)19-14-26-20(23-19)22-17-6-4-16(21)5-7-17/h2-9,14H,10-13H2,1H3,(H,22,23) |
| InChIKey | NEVQCCCNGGMEOX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|