C17H11N7S — CID 169339579
2-[[4-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl]hydrazinylidene]propanedinitrile (PubChem CID 169339579) has the molecular formula C17H11N7S and a molecular weight of 345.39 g/mol. Its IUPAC name is 2-[[4-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[4-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169339579 |
| Molecular Formula | C17H11N7S |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 2-[[4-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl]hydrazinylidene]propanedinitrile |
| SMILES | N#CC(C#N)=NNc1ccc(Nc2nc(-c3ccccn3)cs2)cc1 |
| InChI | InChI=1S/C17H11N7S/c18-9-14(10-19)24-23-13-6-4-12(5-7-13)21-17-22-16(11-25-17)15-3-1-2-8-20-15/h1-8,11,23H,(H,21,22) |
| InChIKey | GSXLKACUNZEFLO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|