C15H10N4OS — CID 108777909
N-(4-pyridin-2-yl-1,3-thiazol-2-yl)-1,3-benzoxazol-2-amine (PubChem CID 108777909) has the molecular formula C15H10N4OS and a molecular weight of 294.34 g/mol. Its IUPAC name is N-(4-pyridin-2-yl-1,3-thiazol-2-yl)-1,3-benzoxazol-2-amine.
| Compound Name | N-(4-pyridin-2-yl-1,3-thiazol-2-yl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 108777909 |
| Molecular Formula | C15H10N4OS |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | N-(4-pyridin-2-yl-1,3-thiazol-2-yl)-1,3-benzoxazol-2-amine |
| SMILES | c1ccc(-c2csc(Nc3nc4ccccc4o3)n2)nc1 |
| InChI | InChI=1S/C15H10N4OS/c1-2-7-13-11(6-1)17-14(20-13)19-15-18-12(9-21-15)10-5-3-4-8-16-10/h1-9H,(H,17,18,19) |
| InChIKey | IRIMIEAIJVPZQP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |