C14H11IN4S — CID 86076382
N-(5-iodo-4-methyl-2-pyridinyl)-4-pyridin-2-yl-1,3-thiazol-2-amine (PubChem CID 86076382) has the molecular formula C14H11IN4S and a molecular weight of 394.24 g/mol. Its IUPAC name is N-(5-iodo-4-methyl-2-pyridinyl)-4-pyridin-2-yl-1,3-thiazol-2-amine.
| Compound Name | N-(5-iodo-4-methyl-2-pyridinyl)-4-pyridin-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 86076382 |
| Molecular Formula | C14H11IN4S |
| Molecular Weight | 394.24 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | N-(5-iodo-4-methyl-2-pyridinyl)-4-pyridin-2-yl-1,3-thiazol-2-amine |
| SMILES | Cc1cc(Nc2nc(-c3ccccn3)cs2)ncc1I |
| InChI | InChI=1S/C14H11IN4S/c1-9-6-13(17-7-10(9)15)19-14-18-12(8-20-14)11-4-2-3-5-16-11/h2-8H,1H3,(H,17,18,19) |
| InChIKey | NNIBOABTGVAHNS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.24 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|