C14H11ClN4S — CID 82059224
2-chloro-1-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzene-1,4-diamine (PubChem CID 82059224) has the molecular formula C14H11ClN4S and a molecular weight of 302.79 g/mol. Its IUPAC name is 2-chloro-1-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzene-1,4-diamine.
| Compound Name | 2-chloro-1-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 82059224 |
| Molecular Formula | C14H11ClN4S |
| Molecular Weight | 302.79 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 2-chloro-1-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2nc(-c3ccccn3)cs2)c(Cl)c1 |
| InChI | InChI=1S/C14H11ClN4S/c15-10-7-9(16)4-5-11(10)18-14-19-13(8-20-14)12-3-1-2-6-17-12/h1-8H,16H2,(H,18,19) |
| InChIKey | OFYYKWJVICNYQR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.79 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|