C19H19N5O2S — CID 117084517
N-(4-morpholin-4-ylphenyl)-2-(pyridin-4-ylamino)-1,3-thiazole-5-carboxamide (PubChem CID 117084517) has the molecular formula C19H19N5O2S and a molecular weight of 381.46 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-2-(pyridin-4-ylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | N-(4-morpholin-4-ylphenyl)-2-(pyridin-4-ylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 117084517 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-2-(pyridin-4-ylamino)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)c1cnc(Nc2ccncc2)s1 |
| InChI | InChI=1S/C19H19N5O2S/c25-18(17-13-21-19(27-17)23-15-5-7-20-8-6-15)22-14-1-3-16(4-2-14)24-9-11-26-12-10-24/h1-8,13H,9-12H2,(H,22,25)(H,20,21,23) |
| InChIKey | OMECEVWJDVTZFR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|