C26H29N5O3S — CID 117085734
2-[4-(4-methylpiperazine-1-carbonyl)phenyl]-N-(4-morpholin-4-ylphenyl)-1,3-thiazole-5-carboxamide (PubChem CID 117085734) has the molecular formula C26H29N5O3S and a molecular weight of 491.62 g/mol. Its IUPAC name is 2-[4-(4-methylpiperazine-1-carbonyl)phenyl]-N-(4-morpholin-4-ylphenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[4-(4-methylpiperazine-1-carbonyl)phenyl]-N-(4-morpholin-4-ylphenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 117085734 |
| Molecular Formula | C26H29N5O3S |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 2-[4-(4-methylpiperazine-1-carbonyl)phenyl]-N-(4-morpholin-4-ylphenyl)-1,3-thiazole-5-carboxamide |
| SMILES | CN1CCN(C(=O)c2ccc(-c3ncc(C(=O)Nc4ccc(N5CCOCC5)cc4)s3)cc2)CC1 |
| InChI | InChI=1S/C26H29N5O3S/c1-29-10-12-31(13-11-29)26(33)20-4-2-19(3-5-20)25-27-18-23(35-25)24(32)28-21-6-8-22(9-7-21)30-14-16-34-17-15-30/h2-9,18H,10-17H2,1H3,(H,28,32) |
| InChIKey | UESDXBJJZWCMOU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|