C27H32N6O3 — CID 134356279
morpholin-4-yl-[4-[6-[1-(4-morpholin-4-ylanilino)ethenylamino]-2,3-dihydropyrazin-5-yl]phenyl]methanone (PubChem CID 134356279) has the molecular formula C27H32N6O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is morpholin-4-yl-[4-[6-[1-(4-morpholin-4-ylanilino)ethenylamino]-2,3-dihydropyrazin-5-yl]phenyl]methanone.
| Compound Name | morpholin-4-yl-[4-[6-[1-(4-morpholin-4-ylanilino)ethenylamino]-2,3-dihydropyrazin-5-yl]phenyl]methanone |
|---|---|
| PubChem CID | 134356279 |
| Molecular Formula | C27H32N6O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | morpholin-4-yl-[4-[6-[1-(4-morpholin-4-ylanilino)ethenylamino]-2,3-dihydropyrazin-5-yl]phenyl]methanone |
| SMILES | C=C(NC1=NCCN=C1c1ccc(C(=O)N2CCOCC2)cc1)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C27H32N6O3/c1-20(30-23-6-8-24(9-7-23)32-12-16-35-17-13-32)31-26-25(28-10-11-29-26)21-2-4-22(5-3-21)27(34)33-14-18-36-19-15-33/h2-9,30H,1,10-19H2,(H,29,31) |
| InChIKey | IVLRZVATLBQLQD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|