C25H29F3N6O2S — CID 177372210
5-tert-butyl-N-methyl-2-[[2-(4-morpholin-4-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]thiophene-3-carboxamide (PubChem CID 177372210) has the molecular formula C25H29F3N6O2S and a molecular weight of 534.61 g/mol. Its IUPAC name is 5-tert-butyl-N-methyl-2-[[2-(4-morpholin-4-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]thiophene-3-carboxamide.
| Compound Name | 5-tert-butyl-N-methyl-2-[[2-(4-morpholin-4-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 177372210 |
| Molecular Formula | C25H29F3N6O2S |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 5-tert-butyl-N-methyl-2-[[2-(4-morpholin-4-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]thiophene-3-carboxamide |
| SMILES | CNC(=O)c1cc(C(C)(C)C)sc1Nc1nc(Nc2ccc(N3CCOCC3)cc2)ncc1C(F)(F)F |
| InChI | InChI=1S/C25H29F3N6O2S/c1-24(2,3)19-13-17(21(35)29-4)22(37-19)32-20-18(25(26,27)28)14-30-23(33-20)31-15-5-7-16(8-6-15)34-9-11-36-12-10-34/h5-8,13-14H,9-12H2,1-4H3,(H,29,35)(H2,30,31,32,33) |
| InChIKey | SMENIOIXBICWSB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|