C19H24N6O3 — CID 68565223
ethyl 1-[4-(3-acetamidoanilino)-1,3,5-triazin-2-yl]piperidine-4-carboxylate (PubChem CID 68565223) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is ethyl 1-[4-(3-acetamidoanilino)-1,3,5-triazin-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-(3-acetamidoanilino)-1,3,5-triazin-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 68565223 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | ethyl 1-[4-(3-acetamidoanilino)-1,3,5-triazin-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncnc(Nc3cccc(NC(C)=O)c3)n2)CC1 |
| InChI | InChI=1S/C19H24N6O3/c1-3-28-17(27)14-7-9-25(10-8-14)19-21-12-20-18(24-19)23-16-6-4-5-15(11-16)22-13(2)26/h4-6,11-12,14H,3,7-10H2,1-2H3,(H,22,26)(H,20,21,23,24) |
| InChIKey | ZZFPRZPCOOCBAW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |