C25H30N6O2 — CID 45137476
N-[3-[[4-[4-(3-phenylpropoxy)piperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]acetamide (PubChem CID 45137476) has the molecular formula C25H30N6O2 and a molecular weight of 446.56 g/mol. Its IUPAC name is N-[3-[[4-[4-(3-phenylpropoxy)piperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[4-[4-(3-phenylpropoxy)piperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 45137476 |
| Molecular Formula | C25H30N6O2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | N-[3-[[4-[4-(3-phenylpropoxy)piperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2ncnc(N3CCC(OCCCc4ccccc4)CC3)n2)c1 |
| InChI | InChI=1S/C25H30N6O2/c1-19(32)28-21-10-5-11-22(17-21)29-24-26-18-27-25(30-24)31-14-12-23(13-15-31)33-16-6-9-20-7-3-2-4-8-20/h2-5,7-8,10-11,17-18,23H,6,9,12-16H2,1H3,(H,28,32)(H,26,27,29,30) |
| InChIKey | SUXFEZKBGCECBG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|