C23H27N7O — CID 45139121
N-[3-[[4-[4-(3,4-dimethylphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]acetamide (PubChem CID 45139121) has the molecular formula C23H27N7O and a molecular weight of 417.52 g/mol. Its IUPAC name is N-[3-[[4-[4-(3,4-dimethylphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[4-[4-(3,4-dimethylphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 45139121 |
| Molecular Formula | C23H27N7O |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | N-[3-[[4-[4-(3,4-dimethylphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2ncnc(N3CCN(c4ccc(C)c(C)c4)CC3)n2)c1 |
| InChI | InChI=1S/C23H27N7O/c1-16-7-8-21(13-17(16)2)29-9-11-30(12-10-29)23-25-15-24-22(28-23)27-20-6-4-5-19(14-20)26-18(3)31/h4-8,13-15H,9-12H2,1-3H3,(H,26,31)(H,24,25,27,28) |
| InChIKey | QUPLVILRPNYEQM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|