C25H23Cl2N7O3 — CID 46213940
2-[4-(4-acetylpiperazin-1-yl)-3-methylanilino]-6-(2,6-dichlorophenyl)-8H-pyrimido[4,5-d]pyrimidine-5,7-dione (PubChem CID 46213940) has the molecular formula C25H23Cl2N7O3 and a molecular weight of 540.41 g/mol. Its IUPAC name is 2-[4-(4-acetylpiperazin-1-yl)-3-methylanilino]-6-(2,6-dichlorophenyl)-8H-pyrimido[4,5-d]pyrimidine-5,7-dione.
| Compound Name | 2-[4-(4-acetylpiperazin-1-yl)-3-methylanilino]-6-(2,6-dichlorophenyl)-8H-pyrimido[4,5-d]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 46213940 |
| Molecular Formula | C25H23Cl2N7O3 |
| Molecular Weight | 540.41 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | 2-[4-(4-acetylpiperazin-1-yl)-3-methylanilino]-6-(2,6-dichlorophenyl)-8H-pyrimido[4,5-d]pyrimidine-5,7-dione |
| SMILES | CC(=O)N1CCN(c2ccc(Nc3ncc4c(=O)n(-c5c(Cl)cccc5Cl)c(=O)[nH]c4n3)cc2C)CC1 |
| InChI | InChI=1S/C25H23Cl2N7O3/c1-14-12-16(6-7-20(14)33-10-8-32(9-11-33)15(2)35)29-24-28-13-17-22(30-24)31-25(37)34(23(17)36)21-18(26)4-3-5-19(21)27/h3-7,12-13H,8-11H2,1-2H3,(H2,28,29,30,31,37) |
| InChIKey | PVKQZPSELITDSM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 116.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|