C25H24Cl2N6O — CID 118189169
6-(2,6-dichlorophenyl)-8-methyl-2-(3-methyl-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-5-one (PubChem CID 118189169) has the molecular formula C25H24Cl2N6O and a molecular weight of 495.41 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-8-methyl-2-(3-methyl-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-5-one.
| Compound Name | 6-(2,6-dichlorophenyl)-8-methyl-2-(3-methyl-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 118189169 |
| Molecular Formula | C25H24Cl2N6O |
| Molecular Weight | 495.41 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-8-methyl-2-(3-methyl-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-5-one |
| SMILES | Cc1cc(Nc2ncc3c(=O)c(-c4c(Cl)cccc4Cl)cn(C)c3n2)ccc1N1CCNCC1 |
| InChI | InChI=1S/C25H24Cl2N6O/c1-15-12-16(6-7-21(15)33-10-8-28-9-11-33)30-25-29-13-17-23(34)18(14-32(2)24(17)31-25)22-19(26)4-3-5-20(22)27/h3-7,12-14,28H,8-11H2,1-2H3,(H,29,30,31) |
| InChIKey | DPYHSLCYZJOLCG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|