C23H24Cl2N6O2 — CID 171834950
N-(2,6-dichlorophenyl)-4-methoxy-2-(3-methyl-4-piperazin-1-ylanilino)pyrimidine-5-carboxamide (PubChem CID 171834950) has the molecular formula C23H24Cl2N6O2 and a molecular weight of 487.39 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-4-methoxy-2-(3-methyl-4-piperazin-1-ylanilino)pyrimidine-5-carboxamide.
| Compound Name | N-(2,6-dichlorophenyl)-4-methoxy-2-(3-methyl-4-piperazin-1-ylanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 171834950 |
| Molecular Formula | C23H24Cl2N6O2 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | N-(2,6-dichlorophenyl)-4-methoxy-2-(3-methyl-4-piperazin-1-ylanilino)pyrimidine-5-carboxamide |
| SMILES | COc1nc(Nc2ccc(N3CCNCC3)c(C)c2)ncc1C(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H24Cl2N6O2/c1-14-12-15(6-7-19(14)31-10-8-26-9-11-31)28-23-27-13-16(22(30-23)33-2)21(32)29-20-17(24)4-3-5-18(20)25/h3-7,12-13,26H,8-11H2,1-2H3,(H,29,32)(H,27,28,30) |
| InChIKey | AUWOOEDJSKEIKN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|