C27H27ClF3N7O2 — CID 141464443
N-[3-[[2-[4-(4-acetylpiperazin-1-yl)-3-methylanilino]-5-chloropyrimidin-4-yl]amino]phenyl]-2-(trifluoromethyl)prop-2-enamide (PubChem CID 141464443) has the molecular formula C27H27ClF3N7O2 and a molecular weight of 574.01 g/mol. Its IUPAC name is N-[3-[[2-[4-(4-acetylpiperazin-1-yl)-3-methylanilino]-5-chloropyrimidin-4-yl]amino]phenyl]-2-(trifluoromethyl)prop-2-enamide.
| Compound Name | N-[3-[[2-[4-(4-acetylpiperazin-1-yl)-3-methylanilino]-5-chloropyrimidin-4-yl]amino]phenyl]-2-(trifluoromethyl)prop-2-enamide |
|---|---|
| PubChem CID | 141464443 |
| Molecular Formula | C27H27ClF3N7O2 |
| Molecular Weight | 574.01 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | N-[3-[[2-[4-(4-acetylpiperazin-1-yl)-3-methylanilino]-5-chloropyrimidin-4-yl]amino]phenyl]-2-(trifluoromethyl)prop-2-enamide |
| SMILES | C=C(C(=O)Nc1cccc(Nc2nc(Nc3ccc(N4CCN(C(C)=O)CC4)c(C)c3)ncc2Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C27H27ClF3N7O2/c1-16-13-21(7-8-23(16)38-11-9-37(10-12-38)18(3)39)35-26-32-15-22(28)24(36-26)33-19-5-4-6-20(14-19)34-25(40)17(2)27(29,30)31/h4-8,13-15H,2,9-12H2,1,3H3,(H,34,40)(H2,32,33,35,36) |
| InChIKey | MULOWHWEWWXZPZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.01 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|