C27H26F6N6O5S — CID 146216301
4-(3-aminophenoxy)-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 146216301) has the molecular formula C27H26F6N6O5S and a molecular weight of 660.60 g/mol. Its IUPAC name is 4-(3-aminophenoxy)-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-(3-aminophenoxy)-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 146216301 |
| Molecular Formula | C27H26F6N6O5S |
| Molecular Weight | 660.60 g/mol |
| Exact Mass | 660.16 |
| IUPAC Name | 4-(3-aminophenoxy)-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN1CCN(c2ccc(Nc3nc(Oc4cccc(N)c4)c4sccc4n3)cc2)CC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H24N6OS.2C2HF3O2/c1-28-10-12-29(13-11-28)18-7-5-17(6-8-18)25-23-26-20-9-14-31-21(20)22(27-23)30-19-4-2-3-16(24)15-19;2*3-2(4,5)1(6)7/h2-9,14-15H,10-13,24H2,1H3,(H,25,26,27);2*(H,6,7) |
| InChIKey | DUHUHUFBQDOKMH-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.60 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|