C19H24N8O — CID 163280858
4-(3-aminophenoxy)-5-(4-methylpiperazin-1-yl)-N-(1-methylpyrazol-4-yl)pyrimidin-2-amine (PubChem CID 163280858) has the molecular formula C19H24N8O and a molecular weight of 380.46 g/mol. Its IUPAC name is 4-(3-aminophenoxy)-5-(4-methylpiperazin-1-yl)-N-(1-methylpyrazol-4-yl)pyrimidin-2-amine.
| Compound Name | 4-(3-aminophenoxy)-5-(4-methylpiperazin-1-yl)-N-(1-methylpyrazol-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 163280858 |
| Molecular Formula | C19H24N8O |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 4-(3-aminophenoxy)-5-(4-methylpiperazin-1-yl)-N-(1-methylpyrazol-4-yl)pyrimidin-2-amine |
| SMILES | CN1CCN(c2cnc(Nc3cnn(C)c3)nc2Oc2cccc(N)c2)CC1 |
| InChI | InChI=1S/C19H24N8O/c1-25-6-8-27(9-7-25)17-12-21-19(23-15-11-22-26(2)13-15)24-18(17)28-16-5-3-4-14(20)10-16/h3-5,10-13H,6-9,20H2,1-2H3,(H,21,23,24) |
| InChIKey | DJDMTDOJUDUZAT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|