C24H24F3N7O5 — CID 155757244
[3-[3-[[2-[(1-methylpyrazol-4-yl)amino]-5-morpholin-4-ylpyrimidin-4-yl]oxymethyl]anilino]-3-oxoprop-1-en-2-yl] 2,2,2-trifluoroacetate (PubChem CID 155757244) has the molecular formula C24H24F3N7O5 and a molecular weight of 547.49 g/mol. Its IUPAC name is [3-[3-[[2-[(1-methylpyrazol-4-yl)amino]-5-morpholin-4-ylpyrimidin-4-yl]oxymethyl]anilino]-3-oxoprop-1-en-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[3-[[2-[(1-methylpyrazol-4-yl)amino]-5-morpholin-4-ylpyrimidin-4-yl]oxymethyl]anilino]-3-oxoprop-1-en-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 155757244 |
| Molecular Formula | C24H24F3N7O5 |
| Molecular Weight | 547.49 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | [3-[3-[[2-[(1-methylpyrazol-4-yl)amino]-5-morpholin-4-ylpyrimidin-4-yl]oxymethyl]anilino]-3-oxoprop-1-en-2-yl] 2,2,2-trifluoroacetate |
| SMILES | C=C(OC(=O)C(F)(F)F)C(=O)Nc1cccc(COc2nc(Nc3cnn(C)c3)ncc2N2CCOCC2)c1 |
| InChI | InChI=1S/C24H24F3N7O5/c1-15(39-22(36)24(25,26)27)20(35)30-17-5-3-4-16(10-17)14-38-21-19(34-6-8-37-9-7-34)12-28-23(32-21)31-18-11-29-33(2)13-18/h3-5,10-13H,1,6-9,14H2,2H3,(H,30,35)(H,28,31,32) |
| InChIKey | NXYPFEPGEYFRPJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 132.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|