C25H27F3N8O5 — CID 155757264
[3-[3-[[2-[[1-(2-methoxyethyl)pyrazol-4-yl]amino]-5-morpholin-4-ylpyrimidin-4-yl]amino]anilino]-3-oxoprop-1-en-2-yl] 2,2,2-trifluoroacetate (PubChem CID 155757264) has the molecular formula C25H27F3N8O5 and a molecular weight of 576.54 g/mol. Its IUPAC name is [3-[3-[[2-[[1-(2-methoxyethyl)pyrazol-4-yl]amino]-5-morpholin-4-ylpyrimidin-4-yl]amino]anilino]-3-oxoprop-1-en-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[3-[[2-[[1-(2-methoxyethyl)pyrazol-4-yl]amino]-5-morpholin-4-ylpyrimidin-4-yl]amino]anilino]-3-oxoprop-1-en-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 155757264 |
| Molecular Formula | C25H27F3N8O5 |
| Molecular Weight | 576.54 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | [3-[3-[[2-[[1-(2-methoxyethyl)pyrazol-4-yl]amino]-5-morpholin-4-ylpyrimidin-4-yl]amino]anilino]-3-oxoprop-1-en-2-yl] 2,2,2-trifluoroacetate |
| SMILES | C=C(OC(=O)C(F)(F)F)C(=O)Nc1cccc(Nc2nc(Nc3cnn(CCOC)c3)ncc2N2CCOCC2)c1 |
| InChI | InChI=1S/C25H27F3N8O5/c1-16(41-23(38)25(26,27)28)22(37)32-18-5-3-4-17(12-18)31-21-20(35-6-10-40-11-7-35)14-29-24(34-21)33-19-13-30-36(15-19)8-9-39-2/h3-5,12-15H,1,6-11H2,2H3,(H,32,37)(H2,29,31,33,34) |
| InChIKey | LTHQZRIIVVRYDZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 144.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|