C22H18F3N5O — CID 163280588
4-(3-aminophenoxy)-N-(1-methylpyrazol-4-yl)-5-[4-(trifluoromethyl)phenyl]pyridin-2-amine (PubChem CID 163280588) has the molecular formula C22H18F3N5O and a molecular weight of 425.41 g/mol. Its IUPAC name is 4-(3-aminophenoxy)-N-(1-methylpyrazol-4-yl)-5-[4-(trifluoromethyl)phenyl]pyridin-2-amine.
| Compound Name | 4-(3-aminophenoxy)-N-(1-methylpyrazol-4-yl)-5-[4-(trifluoromethyl)phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 163280588 |
| Molecular Formula | C22H18F3N5O |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 4-(3-aminophenoxy)-N-(1-methylpyrazol-4-yl)-5-[4-(trifluoromethyl)phenyl]pyridin-2-amine |
| SMILES | Cn1cc(Nc2cc(Oc3cccc(N)c3)c(-c3ccc(C(F)(F)F)cc3)cn2)cn1 |
| InChI | InChI=1S/C22H18F3N5O/c1-30-13-17(11-28-30)29-21-10-20(31-18-4-2-3-16(26)9-18)19(12-27-21)14-5-7-15(8-6-14)22(23,24)25/h2-13H,26H2,1H3,(H,27,29) |
| InChIKey | YCCZGWFODKWULS-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|