C25H31N7O — CID 122475129
1-[3-[6-[4-(4-methylpiperazin-1-yl)anilino]imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 122475129) has the molecular formula C25H31N7O and a molecular weight of 445.57 g/mol. Its IUPAC name is 1-[3-[6-[4-(4-methylpiperazin-1-yl)anilino]imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[6-[4-(4-methylpiperazin-1-yl)anilino]imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122475129 |
| Molecular Formula | C25H31N7O |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | 1-[3-[6-[4-(4-methylpiperazin-1-yl)anilino]imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(c2ncc3cnc(Nc4ccc(N5CCN(C)CC5)cc4)cn23)C1 |
| InChI | InChI=1S/C25H31N7O/c1-3-24(33)31-10-4-5-19(17-31)25-27-16-22-15-26-23(18-32(22)25)28-20-6-8-21(9-7-20)30-13-11-29(2)12-14-30/h3,6-9,15-16,18-19,28H,1,4-5,10-14,17H2,2H3 |
| InChIKey | YPBBUVFGJBFZGE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 69.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|