C23H27N7O2 — CID 118456708
1-[3-[8-[(5-morpholin-4-yl-2-pyridinyl)amino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 118456708) has the molecular formula C23H27N7O2 and a molecular weight of 433.52 g/mol. Its IUPAC name is 1-[3-[8-[(5-morpholin-4-yl-2-pyridinyl)amino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[8-[(5-morpholin-4-yl-2-pyridinyl)amino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118456708 |
| Molecular Formula | C23H27N7O2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 1-[3-[8-[(5-morpholin-4-yl-2-pyridinyl)amino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(c2cc(Nc3ccc(N4CCOCC4)cn3)c3ncnn3c2)C1 |
| InChI | InChI=1S/C23H27N7O2/c1-2-22(31)29-7-3-4-17(14-29)18-12-20(23-25-16-26-30(23)15-18)27-21-6-5-19(13-24-21)28-8-10-32-11-9-28/h2,5-6,12-13,15-17H,1,3-4,7-11,14H2,(H,24,27) |
| InChIKey | HTIFKSLSQQTCSN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|