C23H30N6O2 — CID 156562934
1-[3-[[4-(morpholin-4-ylmethyl)-6-(pyridin-2-ylamino)-2-pyridinyl]amino]piperidin-1-yl]prop-2-en-1-one (PubChem CID 156562934) has the molecular formula C23H30N6O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 1-[3-[[4-(morpholin-4-ylmethyl)-6-(pyridin-2-ylamino)-2-pyridinyl]amino]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[4-(morpholin-4-ylmethyl)-6-(pyridin-2-ylamino)-2-pyridinyl]amino]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156562934 |
| Molecular Formula | C23H30N6O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 1-[3-[[4-(morpholin-4-ylmethyl)-6-(pyridin-2-ylamino)-2-pyridinyl]amino]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(Nc2cc(CN3CCOCC3)cc(Nc3ccccn3)n2)C1 |
| InChI | InChI=1S/C23H30N6O2/c1-2-23(30)29-9-5-6-19(17-29)25-21-14-18(16-28-10-12-31-13-11-28)15-22(27-21)26-20-7-3-4-8-24-20/h2-4,7-8,14-15,19H,1,5-6,9-13,16-17H2,(H2,24,25,26,27) |
| InChIKey | YDSUUUSGAAONPZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|