C21H29N7O2 — CID 156562950
1-[3-[[4-(morpholin-4-ylmethyl)-6-(1H-pyrazol-5-ylamino)-2-pyridinyl]amino]piperidin-1-yl]prop-2-en-1-one (PubChem CID 156562950) has the molecular formula C21H29N7O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 1-[3-[[4-(morpholin-4-ylmethyl)-6-(1H-pyrazol-5-ylamino)-2-pyridinyl]amino]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[4-(morpholin-4-ylmethyl)-6-(1H-pyrazol-5-ylamino)-2-pyridinyl]amino]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156562950 |
| Molecular Formula | C21H29N7O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 1-[3-[[4-(morpholin-4-ylmethyl)-6-(1H-pyrazol-5-ylamino)-2-pyridinyl]amino]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(Nc2cc(CN3CCOCC3)cc(Nc3ccn[nH]3)n2)C1 |
| InChI | InChI=1S/C21H29N7O2/c1-2-21(29)28-7-3-4-17(15-28)23-19-12-16(14-27-8-10-30-11-9-27)13-20(25-19)24-18-5-6-22-26-18/h2,5-6,12-13,17H,1,3-4,7-11,14-15H2,(H3,22,23,24,25,26) |
| InChIKey | UTSIWVWSEJBGKY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|