C26H33FN6O3 — CID 154991959
1-[(3S)-3-[[7-fluoro-3-hydroxy-4-(4-morpholin-4-ylanilino)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridin-6-yl]amino]azepan-1-yl]prop-2-en-1-one (PubChem CID 154991959) has the molecular formula C26H33FN6O3 and a molecular weight of 496.59 g/mol. Its IUPAC name is 1-[(3S)-3-[[7-fluoro-3-hydroxy-4-(4-morpholin-4-ylanilino)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridin-6-yl]amino]azepan-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3S)-3-[[7-fluoro-3-hydroxy-4-(4-morpholin-4-ylanilino)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridin-6-yl]amino]azepan-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 154991959 |
| Molecular Formula | C26H33FN6O3 |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 1-[(3S)-3-[[7-fluoro-3-hydroxy-4-(4-morpholin-4-ylanilino)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridin-6-yl]amino]azepan-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC[C@H](Nc2nc(Nc3ccc(N4CCOCC4)cc3)c3c(c2F)CNC3O)C1 |
| InChI | InChI=1S/C26H33FN6O3/c1-2-21(34)33-10-4-3-5-18(16-33)30-25-23(27)20-15-28-26(35)22(20)24(31-25)29-17-6-8-19(9-7-17)32-11-13-36-14-12-32/h2,6-9,18,26,28,35H,1,3-5,10-16H2,(H2,29,30,31)/t18-,26?/m0/s1 |
| InChIKey | SYPWOEYWZGTRCZ-MDYZWHIJSA-N |
| XLogP | 2.87 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|