C26H30F2N6O3 — CID 146367121
7-fluoro-4-(3-fluoro-4-morpholin-4-ylanilino)-6-[(6-methyl-1-prop-2-enoylpiperidin-3-yl)amino]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one (PubChem CID 146367121) has the molecular formula C26H30F2N6O3 and a molecular weight of 512.56 g/mol. Its IUPAC name is 7-fluoro-4-(3-fluoro-4-morpholin-4-ylanilino)-6-[(6-methyl-1-prop-2-enoylpiperidin-3-yl)amino]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one.
| Compound Name | 7-fluoro-4-(3-fluoro-4-morpholin-4-ylanilino)-6-[(6-methyl-1-prop-2-enoylpiperidin-3-yl)amino]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one |
|---|---|
| PubChem CID | 146367121 |
| Molecular Formula | C26H30F2N6O3 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | 7-fluoro-4-(3-fluoro-4-morpholin-4-ylanilino)-6-[(6-methyl-1-prop-2-enoylpiperidin-3-yl)amino]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one |
| SMILES | C=CC(=O)N1CC(Nc2nc(Nc3ccc(N4CCOCC4)c(F)c3)c3c(c2F)CNC3=O)CCC1C |
| InChI | InChI=1S/C26H30F2N6O3/c1-3-21(35)34-14-17(5-4-15(34)2)31-25-23(28)18-13-29-26(36)22(18)24(32-25)30-16-6-7-20(19(27)12-16)33-8-10-37-11-9-33/h3,6-7,12,15,17H,1,4-5,8-11,13-14H2,2H3,(H,29,36)(H2,30,31,32) |
| InChIKey | OTHRROXESNEIGR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|