C27H36FN9O — CID 118073742
N-[(3R,4R)-1-[9-tert-butyl-6-[4-(4-methylpiperazin-1-yl)anilino]purin-2-yl]-4-fluoropyrrolidin-3-yl]prop-2-enamide (PubChem CID 118073742) has the molecular formula C27H36FN9O and a molecular weight of 521.65 g/mol. Its IUPAC name is N-[(3R,4R)-1-[9-tert-butyl-6-[4-(4-methylpiperazin-1-yl)anilino]purin-2-yl]-4-fluoropyrrolidin-3-yl]prop-2-enamide.
| Compound Name | N-[(3R,4R)-1-[9-tert-butyl-6-[4-(4-methylpiperazin-1-yl)anilino]purin-2-yl]-4-fluoropyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 118073742 |
| Molecular Formula | C27H36FN9O |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | N-[(3R,4R)-1-[9-tert-butyl-6-[4-(4-methylpiperazin-1-yl)anilino]purin-2-yl]-4-fluoropyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1CN(c2nc(Nc3ccc(N4CCN(C)CC4)cc3)c3ncn(C(C)(C)C)c3n2)C[C@H]1F |
| InChI | InChI=1S/C27H36FN9O/c1-6-22(38)31-21-16-36(15-20(21)28)26-32-24(23-25(33-26)37(17-29-23)27(2,3)4)30-18-7-9-19(10-8-18)35-13-11-34(5)12-14-35/h6-10,17,20-21H,1,11-16H2,2-5H3,(H,31,38)(H,30,32,33)/t20-,21-/m1/s1 |
| InChIKey | ISBUKEJWGYIUAI-NHCUHLMSSA-N |
| XLogP | 2.91 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|