C28H44FN9O2 — CID 167458020
tert-butyl N-[5-[4-[[9-tert-butyl-2-[(3S)-3-fluoropyrrolidin-1-yl]purin-6-yl]amino]-3-ethylpyrazol-1-yl]pentyl]carbamate (PubChem CID 167458020) has the molecular formula C28H44FN9O2 and a molecular weight of 557.72 g/mol. Its IUPAC name is tert-butyl N-[5-[4-[[9-tert-butyl-2-[(3S)-3-fluoropyrrolidin-1-yl]purin-6-yl]amino]-3-ethylpyrazol-1-yl]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[4-[[9-tert-butyl-2-[(3S)-3-fluoropyrrolidin-1-yl]purin-6-yl]amino]-3-ethylpyrazol-1-yl]pentyl]carbamate |
|---|---|
| PubChem CID | 167458020 |
| Molecular Formula | C28H44FN9O2 |
| Molecular Weight | 557.72 g/mol |
| Exact Mass | 557.36 |
| IUPAC Name | tert-butyl N-[5-[4-[[9-tert-butyl-2-[(3S)-3-fluoropyrrolidin-1-yl]purin-6-yl]amino]-3-ethylpyrazol-1-yl]pentyl]carbamate |
| SMILES | CCc1nn(CCCCCNC(=O)OC(C)(C)C)cc1Nc1nc(N2CC[C@H](F)C2)nc2c1ncn2C(C)(C)C |
| InChI | InChI=1S/C28H44FN9O2/c1-8-20-21(17-37(35-20)14-11-9-10-13-30-26(39)40-28(5,6)7)32-23-22-24(38(18-31-22)27(2,3)4)34-25(33-23)36-15-12-19(29)16-36/h17-19H,8-16H2,1-7H3,(H,30,39)(H,32,33,34)/t19-/m0/s1 |
| InChIKey | GPGDCTCEABVTSC-IBGZPJMESA-N |
| XLogP | 5.33 |
| TPSA | 115.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.72 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|