C15H18N8O — CID 167204673
1-methyl-2-(4-morpholin-4-yl-7-pyridin-4-ylpyrazolo[1,5-a][1,3,5]triazin-2-yl)hydrazine (PubChem CID 167204673) has the molecular formula C15H18N8O and a molecular weight of 326.36 g/mol. Its IUPAC name is 1-methyl-2-(4-morpholin-4-yl-7-pyridin-4-ylpyrazolo[1,5-a][1,3,5]triazin-2-yl)hydrazine.
| Compound Name | 1-methyl-2-(4-morpholin-4-yl-7-pyridin-4-ylpyrazolo[1,5-a][1,3,5]triazin-2-yl)hydrazine |
|---|---|
| PubChem CID | 167204673 |
| Molecular Formula | C15H18N8O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 1-methyl-2-(4-morpholin-4-yl-7-pyridin-4-ylpyrazolo[1,5-a][1,3,5]triazin-2-yl)hydrazine |
| SMILES | CNNc1nc(N2CCOCC2)n2nc(-c3ccncc3)cc2n1 |
| InChI | InChI=1S/C15H18N8O/c1-16-20-14-18-13-10-12(11-2-4-17-5-3-11)21-23(13)15(19-14)22-6-8-24-9-7-22/h2-5,10,16H,6-9H2,1H3,(H,18,20) |
| InChIKey | CUNMJLCFSZBEPA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|