C23H30N6O2 — CID 90727053
2-[[6-[[(2,3-dimethyl-1H-indol-5-yl)diazenyl]methyl]-4-morpholin-4-yl-2-pyridinyl]oxy]-N-methylethanamine (PubChem CID 90727053) has the molecular formula C23H30N6O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[[6-[[(2,3-dimethyl-1H-indol-5-yl)diazenyl]methyl]-4-morpholin-4-yl-2-pyridinyl]oxy]-N-methylethanamine.
| Compound Name | 2-[[6-[[(2,3-dimethyl-1H-indol-5-yl)diazenyl]methyl]-4-morpholin-4-yl-2-pyridinyl]oxy]-N-methylethanamine |
|---|---|
| PubChem CID | 90727053 |
| Molecular Formula | C23H30N6O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 2-[[6-[[(2,3-dimethyl-1H-indol-5-yl)diazenyl]methyl]-4-morpholin-4-yl-2-pyridinyl]oxy]-N-methylethanamine |
| SMILES | CNCCOc1cc(N2CCOCC2)cc(C/N=N/c2ccc3[nH]c(C)c(C)c3c2)n1 |
| InChI | InChI=1S/C23H30N6O2/c1-16-17(2)26-22-5-4-18(13-21(16)22)28-25-15-19-12-20(29-7-10-30-11-8-29)14-23(27-19)31-9-6-24-3/h4-5,12-14,24,26H,6-11,15H2,1-3H3/b28-25+ |
| InChIKey | OCGIZVFOGCLLJD-AZPGRJICSA-N |
| XLogP | 3.90 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|