C30H36N4O5 — CID 59218180
2,3-dimethyl-N-[2-morpholin-4-yl-6-[2-(3,4,5-trimethoxyphenyl)ethoxy]-4-pyridinyl]-1H-indol-5-amine (PubChem CID 59218180) has the molecular formula C30H36N4O5 and a molecular weight of 532.64 g/mol. Its IUPAC name is 2,3-dimethyl-N-[2-morpholin-4-yl-6-[2-(3,4,5-trimethoxyphenyl)ethoxy]-4-pyridinyl]-1H-indol-5-amine.
| Compound Name | 2,3-dimethyl-N-[2-morpholin-4-yl-6-[2-(3,4,5-trimethoxyphenyl)ethoxy]-4-pyridinyl]-1H-indol-5-amine |
|---|---|
| PubChem CID | 59218180 |
| Molecular Formula | C30H36N4O5 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | 2,3-dimethyl-N-[2-morpholin-4-yl-6-[2-(3,4,5-trimethoxyphenyl)ethoxy]-4-pyridinyl]-1H-indol-5-amine |
| SMILES | COc1cc(CCOc2cc(Nc3ccc4[nH]c(C)c(C)c4c3)cc(N3CCOCC3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C30H36N4O5/c1-19-20(2)31-25-7-6-22(16-24(19)25)32-23-17-28(34-9-12-38-13-10-34)33-29(18-23)39-11-8-21-14-26(35-3)30(37-5)27(15-21)36-4/h6-7,14-18,31H,8-13H2,1-5H3,(H,32,33) |
| InChIKey | DEYLRVGASDUZLJ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|