C25H29N5O3 — CID 11362859
N-(2,3-dimethyl-1H-indol-6-yl)-2-(2-methoxyethoxy)-4-morpholin-4-ylquinazolin-6-amine (PubChem CID 11362859) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is N-(2,3-dimethyl-1H-indol-6-yl)-2-(2-methoxyethoxy)-4-morpholin-4-ylquinazolin-6-amine.
| Compound Name | N-(2,3-dimethyl-1H-indol-6-yl)-2-(2-methoxyethoxy)-4-morpholin-4-ylquinazolin-6-amine |
|---|---|
| PubChem CID | 11362859 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | N-(2,3-dimethyl-1H-indol-6-yl)-2-(2-methoxyethoxy)-4-morpholin-4-ylquinazolin-6-amine |
| SMILES | COCCOc1nc(N2CCOCC2)c2cc(Nc3ccc4c(C)c(C)[nH]c4c3)ccc2n1 |
| InChI | InChI=1S/C25H29N5O3/c1-16-17(2)26-23-15-19(4-6-20(16)23)27-18-5-7-22-21(14-18)24(30-8-10-32-11-9-30)29-25(28-22)33-13-12-31-3/h4-7,14-15,26-27H,8-13H2,1-3H3 |
| InChIKey | QSNJLSFQSDCHGI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 84.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|