C25H33N7O3 — CID 59258559
N-(2,3-dimethyl-1H-indol-5-yl)-2-morpholin-4-yl-6-(2-piperazin-1-ylethoxy)pyrimidine-4-carboxamide (PubChem CID 59258559) has the molecular formula C25H33N7O3 and a molecular weight of 479.59 g/mol. Its IUPAC name is N-(2,3-dimethyl-1H-indol-5-yl)-2-morpholin-4-yl-6-(2-piperazin-1-ylethoxy)pyrimidine-4-carboxamide.
| Compound Name | N-(2,3-dimethyl-1H-indol-5-yl)-2-morpholin-4-yl-6-(2-piperazin-1-ylethoxy)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 59258559 |
| Molecular Formula | C25H33N7O3 |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | N-(2,3-dimethyl-1H-indol-5-yl)-2-morpholin-4-yl-6-(2-piperazin-1-ylethoxy)pyrimidine-4-carboxamide |
| SMILES | Cc1[nH]c2ccc(NC(=O)c3cc(OCCN4CCNCC4)nc(N4CCOCC4)n3)cc2c1C |
| InChI | InChI=1S/C25H33N7O3/c1-17-18(2)27-21-4-3-19(15-20(17)21)28-24(33)22-16-23(35-14-9-31-7-5-26-6-8-31)30-25(29-22)32-10-12-34-13-11-32/h3-4,15-16,26-27H,5-14H2,1-2H3,(H,28,33) |
| InChIKey | IVLCWGBGTOSIFA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 107.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|