C23H30N6O4 — CID 11568703
6-[bis(2-hydroxyethyl)amino]-N-(2,3-dimethyl-1H-indol-5-yl)-2-morpholin-4-ylpyrimidine-4-carboxamide (PubChem CID 11568703) has the molecular formula C23H30N6O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 6-[bis(2-hydroxyethyl)amino]-N-(2,3-dimethyl-1H-indol-5-yl)-2-morpholin-4-ylpyrimidine-4-carboxamide.
| Compound Name | 6-[bis(2-hydroxyethyl)amino]-N-(2,3-dimethyl-1H-indol-5-yl)-2-morpholin-4-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 11568703 |
| Molecular Formula | C23H30N6O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 6-[bis(2-hydroxyethyl)amino]-N-(2,3-dimethyl-1H-indol-5-yl)-2-morpholin-4-ylpyrimidine-4-carboxamide |
| SMILES | Cc1[nH]c2ccc(NC(=O)c3cc(N(CCO)CCO)nc(N4CCOCC4)n3)cc2c1C |
| InChI | InChI=1S/C23H30N6O4/c1-15-16(2)24-19-4-3-17(13-18(15)19)25-22(32)20-14-21(28(5-9-30)6-10-31)27-23(26-20)29-7-11-33-12-8-29/h3-4,13-14,24,30-31H,5-12H2,1-2H3,(H,25,32) |
| InChIKey | LCSCDUZYJLGUET-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|