C25H30N4O3 — CID 58060148
2-(2,3-dimethyl-1H-indol-5-yl)-1-(4,6-dimorpholin-4-yl-2-pyridinyl)ethanone (PubChem CID 58060148) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-(2,3-dimethyl-1H-indol-5-yl)-1-(4,6-dimorpholin-4-yl-2-pyridinyl)ethanone.
| Compound Name | 2-(2,3-dimethyl-1H-indol-5-yl)-1-(4,6-dimorpholin-4-yl-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 58060148 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 2-(2,3-dimethyl-1H-indol-5-yl)-1-(4,6-dimorpholin-4-yl-2-pyridinyl)ethanone |
| SMILES | Cc1[nH]c2ccc(CC(=O)c3cc(N4CCOCC4)cc(N4CCOCC4)n3)cc2c1C |
| InChI | InChI=1S/C25H30N4O3/c1-17-18(2)26-22-4-3-19(13-21(17)22)14-24(30)23-15-20(28-5-9-31-10-6-28)16-25(27-23)29-7-11-32-12-8-29/h3-4,13,15-16,26H,5-12,14H2,1-2H3 |
| InChIKey | WKBJXWSAYWWJEL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|