C28H36N4O3 — CID 58060129
4-[2-[[2-[(2,3-dimethyl-1H-indol-5-yl)methyl]-6-morpholin-4-yl-4-pyridinyl]oxy]ethyl]-1-methylpiperidin-2-one (PubChem CID 58060129) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is 4-[2-[[2-[(2,3-dimethyl-1H-indol-5-yl)methyl]-6-morpholin-4-yl-4-pyridinyl]oxy]ethyl]-1-methylpiperidin-2-one.
| Compound Name | 4-[2-[[2-[(2,3-dimethyl-1H-indol-5-yl)methyl]-6-morpholin-4-yl-4-pyridinyl]oxy]ethyl]-1-methylpiperidin-2-one |
|---|---|
| PubChem CID | 58060129 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | 4-[2-[[2-[(2,3-dimethyl-1H-indol-5-yl)methyl]-6-morpholin-4-yl-4-pyridinyl]oxy]ethyl]-1-methylpiperidin-2-one |
| SMILES | Cc1[nH]c2ccc(Cc3cc(OCCC4CCN(C)C(=O)C4)cc(N4CCOCC4)n3)cc2c1C |
| InChI | InChI=1S/C28H36N4O3/c1-19-20(2)29-26-5-4-22(15-25(19)26)14-23-17-24(18-27(30-23)32-9-12-34-13-10-32)35-11-7-21-6-8-31(3)28(33)16-21/h4-5,15,17-18,21,29H,6-14,16H2,1-3H3 |
| InChIKey | FMILPXDPXXNGJF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|