C31H35N3O2 — CID 118666879
3-[2-[(2,3-dimethyl-1H-indol-5-yl)methyl]phenyl]-4-[2-(4-methoxyphenyl)ethyl]piperazine-1-carbaldehyde (PubChem CID 118666879) has the molecular formula C31H35N3O2 and a molecular weight of 481.64 g/mol. Its IUPAC name is 3-[2-[(2,3-dimethyl-1H-indol-5-yl)methyl]phenyl]-4-[2-(4-methoxyphenyl)ethyl]piperazine-1-carbaldehyde.
| Compound Name | 3-[2-[(2,3-dimethyl-1H-indol-5-yl)methyl]phenyl]-4-[2-(4-methoxyphenyl)ethyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 118666879 |
| Molecular Formula | C31H35N3O2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | 3-[2-[(2,3-dimethyl-1H-indol-5-yl)methyl]phenyl]-4-[2-(4-methoxyphenyl)ethyl]piperazine-1-carbaldehyde |
| SMILES | COc1ccc(CCN2CCN(C=O)CC2c2ccccc2Cc2ccc3[nH]c(C)c(C)c3c2)cc1 |
| InChI | InChI=1S/C31H35N3O2/c1-22-23(2)32-30-13-10-25(19-29(22)30)18-26-6-4-5-7-28(26)31-20-33(21-35)16-17-34(31)15-14-24-8-11-27(36-3)12-9-24/h4-13,19,21,31-32H,14-18,20H2,1-3H3 |
| InChIKey | YRISISQBRGKXOU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|