C21H32N7O2+ — CID 143533487
3-[(2E)-2-[[6-(dipropylamino)-2-[2-(methylamino)ethoxy]pyrimidin-1-ium-4-yl]methylidene]hydrazinyl]benzamide (PubChem CID 143533487) has the molecular formula C21H32N7O2+ and a molecular weight of 414.53 g/mol. Its IUPAC name is 3-[(2E)-2-[[6-(dipropylamino)-2-[2-(methylamino)ethoxy]pyrimidin-1-ium-4-yl]methylidene]hydrazinyl]benzamide.
| Compound Name | 3-[(2E)-2-[[6-(dipropylamino)-2-[2-(methylamino)ethoxy]pyrimidin-1-ium-4-yl]methylidene]hydrazinyl]benzamide |
|---|---|
| PubChem CID | 143533487 |
| Molecular Formula | C21H32N7O2+ |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 3-[(2E)-2-[[6-(dipropylamino)-2-[2-(methylamino)ethoxy]pyrimidin-1-ium-4-yl]methylidene]hydrazinyl]benzamide |
| SMILES | CCCN(CCC)c1cc(/C=N/Nc2cccc(C(N)=O)c2)nc(OCCNC)[nH+]1 |
| InChI | InChI=1S/C21H31N7O2/c1-4-10-28(11-5-2)19-14-18(25-21(26-19)30-12-9-23-3)15-24-27-17-8-6-7-16(13-17)20(22)29/h6-8,13-15,23,27H,4-5,9-12H2,1-3H3,(H2,22,29)/p+1/b24-15+ |
| InChIKey | UXYNJACQBRCVAI-BUVRLJJBSA-O |
| XLogP | 1.67 |
| TPSA | 119.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|