C21H26N6O4 — CID 66682707
3-[2-[4-[[(3-methylphenyl)hydrazinylidene]methyl]-6-morpholin-4-ylpyrimidin-2-yl]oxyethyl]-1,3-oxazolidin-2-one (PubChem CID 66682707) has the molecular formula C21H26N6O4 and a molecular weight of 426.48 g/mol. Its IUPAC name is 3-[2-[4-[[(3-methylphenyl)hydrazinylidene]methyl]-6-morpholin-4-ylpyrimidin-2-yl]oxyethyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-[4-[[(3-methylphenyl)hydrazinylidene]methyl]-6-morpholin-4-ylpyrimidin-2-yl]oxyethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 66682707 |
| Molecular Formula | C21H26N6O4 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 3-[2-[4-[[(3-methylphenyl)hydrazinylidene]methyl]-6-morpholin-4-ylpyrimidin-2-yl]oxyethyl]-1,3-oxazolidin-2-one |
| SMILES | Cc1cccc(NN=Cc2cc(N3CCOCC3)nc(OCCN3CCOC3=O)n2)c1 |
| InChI | InChI=1S/C21H26N6O4/c1-16-3-2-4-17(13-16)25-22-15-18-14-19(26-5-9-29-10-6-26)24-20(23-18)30-11-7-27-8-12-31-21(27)28/h2-4,13-15,25H,5-12H2,1H3 |
| InChIKey | WXWLFWGICWLFJA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|