C23H27F2N5O4 — CID 59673870
3-[2-[[4-[(2E)-2-[(3,4-dimethylphenyl)methylidene]hydrazinyl]-3,5-difluoro-6-morpholin-4-yl-2-pyridinyl]oxy]ethyl]-1,3-oxazolidin-2-one (PubChem CID 59673870) has the molecular formula C23H27F2N5O4 and a molecular weight of 475.50 g/mol. Its IUPAC name is 3-[2-[[4-[(2E)-2-[(3,4-dimethylphenyl)methylidene]hydrazinyl]-3,5-difluoro-6-morpholin-4-yl-2-pyridinyl]oxy]ethyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-[[4-[(2E)-2-[(3,4-dimethylphenyl)methylidene]hydrazinyl]-3,5-difluoro-6-morpholin-4-yl-2-pyridinyl]oxy]ethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59673870 |
| Molecular Formula | C23H27F2N5O4 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 3-[2-[[4-[(2E)-2-[(3,4-dimethylphenyl)methylidene]hydrazinyl]-3,5-difluoro-6-morpholin-4-yl-2-pyridinyl]oxy]ethyl]-1,3-oxazolidin-2-one |
| SMILES | Cc1ccc(/C=N/Nc2c(F)c(OCCN3CCOC3=O)nc(N3CCOCC3)c2F)cc1C |
| InChI | InChI=1S/C23H27F2N5O4/c1-15-3-4-17(13-16(15)2)14-26-28-20-18(24)21(29-5-9-32-10-6-29)27-22(19(20)25)33-11-7-30-8-12-34-23(30)31/h3-4,13-14H,5-12H2,1-2H3,(H,27,28)/b26-14+ |
| InChIKey | CNVDSIDLWOOSBL-VULFUBBASA-N |
| XLogP | 3.09 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|